C15H19Cl2N3O3 — CID 126002300
N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 126002300) has the molecular formula C15H19Cl2N3O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 126002300 |
| Molecular Formula | C15H19Cl2N3O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[(E)-(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | CCOc1c(Cl)cc(/C=N/NC(=O)CN2CCOCC2)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O3/c1-2-23-15-12(16)7-11(8-13(15)17)9-18-19-14(21)10-20-3-5-22-6-4-20/h7-9H,2-6,10H2,1H3,(H,19,21)/b18-9+ |
| InChIKey | KNPIZUQNKLXGPB-GIJQJNRQSA-N |
| XLogP | 2.17 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|