C21H30N4O6 — CID 126018159
N-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 126018159) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is N-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 126018159 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-[(Z)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CN2CCOCC2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H30N4O6/c1-2-30-19-13-17(14-22-23-20(26)15-24-5-9-28-10-6-24)3-4-18(19)31-16-21(27)25-7-11-29-12-8-25/h3-4,13-14H,2,5-12,15-16H2,1H3,(H,23,26)/b22-14- |
| InChIKey | GWMYQYZWNJQASE-HMAPJEAMSA-N |
| XLogP | 0.11 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|