C17H22N4O4 — CID 3696139
N-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 3696139) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 3696139 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | CCOc1cc(C=NNC(=O)CN2CCOCC2)ccc1OCC#N |
| InChI | InChI=1S/C17H22N4O4/c1-2-24-16-11-14(3-4-15(16)25-8-5-18)12-19-20-17(22)13-21-6-9-23-10-7-21/h3-4,11-12H,2,6-10,13H2,1H3,(H,20,22) |
| InChIKey | ACMSVGOSPWKUPG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|