C15H12F7N3O3 — CID 39366622
N-[(E)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 39366622) has the molecular formula C15H12F7N3O3 and a molecular weight of 415.27 g/mol. Its IUPAC name is N-[(E)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[(E)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 39366622 |
| Molecular Formula | C15H12F7N3O3 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[(E)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(F)(F)C(F)(F)C(F)(F)F)ccc1OCC#N |
| InChI | InChI=1S/C15H12F7N3O3/c1-2-27-11-7-9(3-4-10(11)28-6-5-23)8-24-25-12(26)13(16,17)14(18,19)15(20,21)22/h3-4,7-8H,2,6H2,1H3,(H,25,26)/b24-8+ |
| InChIKey | XZSUKMKUDFYAJC-KTZMUZOWSA-N |
| XLogP | 3.27 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|