C25H26N4O5 — CID 6105690
1,3-bis[(Z)-(3-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]urea (PubChem CID 6105690) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 1,3-bis[(Z)-(3-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]urea.
| Compound Name | 1,3-bis[(Z)-(3-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 6105690 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1,3-bis[(Z)-(3-ethoxy-4-prop-2-ynoxyphenyl)methylideneamino]urea |
| SMILES | C#CCOc1ccc(/C=N\NC(=O)N/N=C\c2ccc(OCC#C)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C25H26N4O5/c1-5-13-33-21-11-9-19(15-23(21)31-7-3)17-26-28-25(30)29-27-18-20-10-12-22(34-14-6-2)24(16-20)32-8-4/h1-2,9-12,15-18H,7-8,13-14H2,3-4H3,(H2,28,29,30)/b26-17-,27-18- |
| InChIKey | XUUYWDOUZUBHCM-HXNKFHKOSA-N |
| XLogP | 3.18 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|