C25H29ClN4O5 — CID 126022444
(2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylpentanamide (PubChem CID 126022444) has the molecular formula C25H29ClN4O5 and a molecular weight of 500.98 g/mol. Its IUPAC name is (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126022444 |
| Molecular Formula | C25H29ClN4O5 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (2S)-2-[[2-(4-chlorophenoxy)acetyl]amino]-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylpentanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)COc2ccc(Cl)cc2)ccc1OCC#N |
| InChI | InChI=1S/C25H29ClN4O5/c1-4-33-23-14-18(5-10-22(23)34-12-11-27)15-28-30-25(32)21(13-17(2)3)29-24(31)16-35-20-8-6-19(26)7-9-20/h5-10,14-15,17,21H,4,12-13,16H2,1-3H3,(H,29,31)(H,30,32)/b28-15-/t21-/m0/s1 |
| InChIKey | OYGSCALATNEXMB-IPPDYPEDSA-N |
| XLogP | 3.70 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|