C24H30ClN3O6 — CID 126025591
(2R)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide (PubChem CID 126025591) has the molecular formula C24H30ClN3O6 and a molecular weight of 491.97 g/mol. Its IUPAC name is (2R)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide.
| Compound Name | (2R)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 126025591 |
| Molecular Formula | C24H30ClN3O6 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (2R)-2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pentanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H](CC(C)C)NC(=O)COc2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30ClN3O6/c1-15(2)10-19(27-22(29)14-34-18-8-6-17(25)7-9-18)24(30)28-26-13-16-11-20(31-3)23(33-5)21(12-16)32-4/h6-9,11-13,15,19H,10,14H2,1-5H3,(H,27,29)(H,28,30)/b26-13-/t19-/m1/s1 |
| InChIKey | VDLYJJLOHACLGY-KSMZKSHNSA-N |
| XLogP | 3.43 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|