C30H32N4O5 — CID 126025831
(2S)-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 126025831) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126025831 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | (2S)-N-[(Z)-[4-(cyanomethoxy)-3-ethoxyphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](Cc2ccccc2)NC(=O)COc2c(C)cccc2C)ccc1OCC#N |
| InChI | InChI=1S/C30H32N4O5/c1-4-37-27-18-24(13-14-26(27)38-16-15-31)19-32-34-30(36)25(17-23-11-6-5-7-12-23)33-28(35)20-39-29-21(2)9-8-10-22(29)3/h5-14,18-19,25H,4,16-17,20H2,1-3H3,(H,33,35)(H,34,36)/b32-19-/t25-/m0/s1 |
| InChIKey | WEVRSIMCGCINCJ-FBFWLGMHSA-N |
| XLogP | 3.86 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|