C38H39Cl2N3O5 — CID 126019069
(2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 126019069) has the molecular formula C38H39Cl2N3O5 and a molecular weight of 688.65 g/mol. Its IUPAC name is (2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126019069 |
| Molecular Formula | C38H39Cl2N3O5 |
| Molecular Weight | 688.65 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | (2R)-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)[C@@H](Cc2ccccc2)NC(=O)COc2c(C)cccc2C)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C38H39Cl2N3O5/c1-5-11-29-18-28(20-34(46-6-2)37(29)47-23-30-16-17-31(39)21-32(30)40)22-41-43-38(45)33(19-27-14-8-7-9-15-27)42-35(44)24-48-36-25(3)12-10-13-26(36)4/h5,7-10,12-18,20-22,33H,1,6,11,19,23-24H2,2-4H3,(H,42,44)(H,43,45)/b41-22-/t33-/m1/s1 |
| InChIKey | IFMNBSXTZNCMEC-XYACOCBUSA-N |
| XLogP | 7.57 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|