C28H26ClN3O3 — CID 126057339
3-chloro-N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4-methylbenzamide (PubChem CID 126057339) has the molecular formula C28H26ClN3O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 126057339 |
| Molecular Formula | C28H26ClN3O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-[(2-cyanophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4-methylbenzamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)c2ccc(C)c(Cl)c2)cc(OCC)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C28H26ClN3O3/c1-4-8-21-13-20(17-31-32-28(33)22-12-11-19(3)25(29)15-22)14-26(34-5-2)27(21)35-18-24-10-7-6-9-23(24)16-30/h4,6-7,9-15,17H,1,5,8,18H2,2-3H3,(H,32,33)/b31-17- |
| InChIKey | DLZJAHKGVCFVRW-LJUMEUDFSA-N |
| XLogP | 5.99 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|