C31H33Cl2N3O4 — CID 3300022
N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3300022) has the molecular formula C31H33Cl2N3O4 and a molecular weight of 582.53 g/mol. Its IUPAC name is N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3300022 |
| Molecular Formula | C31H33Cl2N3O4 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | N-[1-[2-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | C=CCc1cc(C=NNC(=O)C(NC(=O)c2ccccc2)C(C)C)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H33Cl2N3O4/c1-5-10-23-15-21(16-27(39-6-2)29(23)40-19-24-13-14-25(32)17-26(24)33)18-34-36-31(38)28(20(3)4)35-30(37)22-11-8-7-9-12-22/h5,7-9,11-18,20,28H,1,6,10,19H2,2-4H3,(H,35,37)(H,36,38) |
| InChIKey | UKCRSXRCGVJHEA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|