C30H31Cl2N3O5 — CID 5175013
N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-N-(2-methoxyphenyl)butanediamide (PubChem CID 5175013) has the molecular formula C30H31Cl2N3O5 and a molecular weight of 584.50 g/mol. Its IUPAC name is N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-N-(2-methoxyphenyl)butanediamide.
| Compound Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-N-(2-methoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 5175013 |
| Molecular Formula | C30H31Cl2N3O5 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-N-(2-methoxyphenyl)butanediamide |
| SMILES | C=CCc1cc(C=NNC(=O)CCC(=O)Nc2ccccc2OC)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H31Cl2N3O5/c1-4-8-21-15-20(16-27(39-5-2)30(21)40-19-22-11-12-23(31)17-24(22)32)18-33-35-29(37)14-13-28(36)34-25-9-6-7-10-26(25)38-3/h4,6-7,9-12,15-18H,1,5,8,13-14,19H2,2-3H3,(H,34,36)(H,35,37) |
| InChIKey | XCZOTJNGFXCICD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|