C35H29Cl2N3O3 — CID 126049865
N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126049865) has the molecular formula C35H29Cl2N3O3 and a molecular weight of 610.54 g/mol. Its IUPAC name is N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126049865 |
| Molecular Formula | C35H29Cl2N3O3 |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C35H29Cl2N3O3/c1-3-10-25-17-23(18-33(42-4-2)34(25)43-22-26-15-16-27(36)19-30(26)37)21-38-40-35(41)29-20-32(24-11-6-5-7-12-24)39-31-14-9-8-13-28(29)31/h3,5-9,11-21H,1,4,10,22H2,2H3,(H,40,41)/b38-21+ |
| InChIKey | MGRHMQKRNLKBAR-BBUXEPKYSA-N |
| XLogP | 8.68 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|