C31H22BrCl2N3O3 — CID 126048224
N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126048224) has the molecular formula C31H22BrCl2N3O3 and a molecular weight of 635.35 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126048224 |
| Molecular Formula | C31H22BrCl2N3O3 |
| Molecular Weight | 635.35 g/mol |
| Exact Mass | 633.02 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc(-c3ccccc3)nc3ccccc23)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H22BrCl2N3O3/c1-39-29-14-19(13-25(32)30(29)40-18-21-11-12-22(33)15-26(21)34)17-35-37-31(38)24-16-28(20-7-3-2-4-8-20)36-27-10-6-5-9-23(24)27/h2-17H,18H2,1H3,(H,37,38)/b35-17+ |
| InChIKey | JWTWMVJEWIOJEP-XJECJHNESA-N |
| XLogP | 8.32 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.35 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|