C26H20BrCl2N3O3S2 — CID 19194399
N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 19194399) has the molecular formula C26H20BrCl2N3O3S2 and a molecular weight of 637.41 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19194399 |
| Molecular Formula | C26H20BrCl2N3O3S2 |
| Molecular Weight | 637.41 g/mol |
| Exact Mass | 634.95 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)CSc2nc(-c3ccccc3)cs2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H20BrCl2N3O3S2/c1-34-23-10-16(9-20(27)25(23)35-13-18-7-8-19(28)11-21(18)29)12-30-32-24(33)15-37-26-31-22(14-36-26)17-5-3-2-4-6-17/h2-12,14H,13,15H2,1H3,(H,32,33)/b30-12+ |
| InChIKey | CHMMTKHDNOEDFJ-PNQUVVCRSA-N |
| XLogP | 7.71 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.41 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|