C20H18BrN3O3S2 — CID 135827347
N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 135827347) has the molecular formula C20H18BrN3O3S2 and a molecular weight of 492.42 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135827347 |
| Molecular Formula | C20H18BrN3O3S2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CSc2nc(-c3ccccc3)cs2)cc(Br)c1O |
| InChI | InChI=1S/C20H18BrN3O3S2/c1-2-27-17-9-13(8-15(21)19(17)26)10-22-24-18(25)12-29-20-23-16(11-28-20)14-6-4-3-5-7-14/h3-11,26H,2,12H2,1H3,(H,24,25)/b22-10+ |
| InChIKey | FYGQUWJCTANOOK-LSHDLFTRSA-N |
| XLogP | 4.92 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|