C22H22BrN3O2S2 — CID 19194381
N-[(E)-(5-bromo-2-butoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 19194381) has the molecular formula C22H22BrN3O2S2 and a molecular weight of 504.48 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-butoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(5-bromo-2-butoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19194381 |
| Molecular Formula | C22H22BrN3O2S2 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | N-[(E)-(5-bromo-2-butoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCCCOc1ccc(Br)cc1/C=N/NC(=O)CSc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H22BrN3O2S2/c1-2-3-11-28-20-10-9-18(23)12-17(20)13-24-26-21(27)15-30-22-25-19(14-29-22)16-7-5-4-6-8-16/h4-10,12-14H,2-3,11,15H2,1H3,(H,26,27)/b24-13+ |
| InChIKey | KRJIMPJPNDLZQH-ZMOGYAJESA-N |
| XLogP | 5.99 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|