C27H23Br2N3O3S2 — CID 19194430
N-[(E)-[3-bromo-4-[(3-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 19194430) has the molecular formula C27H23Br2N3O3S2 and a molecular weight of 661.44 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(3-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(3-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19194430 |
| Molecular Formula | C27H23Br2N3O3S2 |
| Molecular Weight | 661.44 g/mol |
| Exact Mass | 658.95 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(3-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CSc2nc(-c3ccccc3)cs2)cc(Br)c1OCc1cccc(Br)c1 |
| InChI | InChI=1S/C27H23Br2N3O3S2/c1-2-34-24-13-19(12-22(29)26(24)35-15-18-7-6-10-21(28)11-18)14-30-32-25(33)17-37-27-31-23(16-36-27)20-8-4-3-5-9-20/h3-14,16H,2,15,17H2,1H3,(H,32,33)/b30-14+ |
| InChIKey | FHSYGEJEYWHYBX-AMVVHIIESA-N |
| XLogP | 7.56 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.44 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|