C25H25BrN4O5S2 — CID 19194409
N-[(E)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 19194409) has the molecular formula C25H25BrN4O5S2 and a molecular weight of 605.54 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19194409 |
| Molecular Formula | C25H25BrN4O5S2 |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 604.04 |
| IUPAC Name | N-[(E)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)CSc2nc(-c3ccccc3)cs2)cc(Br)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H25BrN4O5S2/c1-33-21-12-17(11-19(26)24(21)35-14-23(32)30-7-9-34-10-8-30)13-27-29-22(31)16-37-25-28-20(15-36-25)18-5-3-2-4-6-18/h2-6,11-13,15H,7-10,14,16H2,1H3,(H,29,31)/b27-13+ |
| InChIKey | ACYDJEKAKCRJBB-UVHMKAGCSA-N |
| XLogP | 4.06 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|