C25H29N3O3S2 — CID 19194452
N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 19194452) has the molecular formula C25H29N3O3S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19194452 |
| Molecular Formula | C25H29N3O3S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CSc2nc(-c3ccccc3)cs2)ccc1OCCC(C)C |
| InChI | InChI=1S/C25H29N3O3S2/c1-4-30-23-14-19(10-11-22(23)31-13-12-18(2)3)15-26-28-24(29)17-33-25-27-21(16-32-25)20-8-6-5-7-9-20/h5-11,14-16,18H,4,12-13,17H2,1-3H3,(H,28,29)/b26-15+ |
| InChIKey | BCLXCZTYEOTDNL-CVKSISIWSA-N |
| XLogP | 5.88 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|