C25H28ClN3O3S2 — CID 19194657
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]acetamide (PubChem CID 19194657) has the molecular formula C25H28ClN3O3S2 and a molecular weight of 518.10 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19194657 |
| Molecular Formula | C25H28ClN3O3S2 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-[3-ethoxy-4-(3-methylbutoxy)phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CSc2nc(-c3ccc(Cl)cc3)cs2)ccc1OCCC(C)C |
| InChI | InChI=1S/C25H28ClN3O3S2/c1-4-31-23-13-18(5-10-22(23)32-12-11-17(2)3)14-27-29-24(30)16-34-25-28-21(15-33-25)19-6-8-20(26)9-7-19/h5-10,13-15,17H,4,11-12,16H2,1-3H3,(H,29,30)/b27-14+ |
| InChIKey | KRKWXHAWMHSQEY-MZJWZYIUSA-N |
| XLogP | 6.53 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|