C24H26ClN3O2S2 — CID 19194553
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hexoxyphenyl)methylideneamino]acetamide (PubChem CID 19194553) has the molecular formula C24H26ClN3O2S2 and a molecular weight of 488.08 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hexoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hexoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19194553 |
| Molecular Formula | C24H26ClN3O2S2 |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hexoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCCOc1ccc(/C=N/NC(=O)CSc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H26ClN3O2S2/c1-2-3-4-5-14-30-21-12-6-18(7-13-21)15-26-28-23(29)17-32-24-27-22(16-31-24)19-8-10-20(25)11-9-19/h6-13,15-16H,2-5,14,17H2,1H3,(H,28,29)/b26-15+ |
| InChIKey | JCRLMGLQEGICNG-CVKSISIWSA-N |
| XLogP | 6.66 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|