C28H28ClN5O2S — CID 3709783
2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-pentoxyphenyl)methylideneamino]acetamide (PubChem CID 3709783) has the molecular formula C28H28ClN5O2S and a molecular weight of 534.09 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-pentoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-pentoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3709783 |
| Molecular Formula | C28H28ClN5O2S |
| Molecular Weight | 534.09 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-pentoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCOc1ccc(C=NNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H28ClN5O2S/c1-2-3-7-18-36-25-16-10-21(11-17-25)19-30-31-26(35)20-37-28-33-32-27(22-8-5-4-6-9-22)34(28)24-14-12-23(29)13-15-24/h4-6,8-17,19H,2-3,7,18,20H2,1H3,(H,31,35) |
| InChIKey | BYJFPPFVIHSFPL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.09 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|