C30H23Cl2N5O2S — CID 6891869
2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6891869) has the molecular formula C30H23Cl2N5O2S and a molecular weight of 588.52 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6891869 |
| Molecular Formula | C30H23Cl2N5O2S |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1)N/N=C/c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H23Cl2N5O2S/c31-24-10-8-23(9-11-24)29-35-36-30(37(29)26-14-12-25(32)13-15-26)40-20-28(38)34-33-18-21-6-16-27(17-7-21)39-19-22-4-2-1-3-5-22/h1-18H,19-20H2,(H,34,38)/b33-18+ |
| InChIKey | RBUVWVBCLVMDGQ-DPNNOFEESA-N |
| XLogP | 7.06 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|