C25H20ClN3O2S2 — CID 19194461
N-[(E)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 19194461) has the molecular formula C25H20ClN3O2S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19194461 |
| Molecular Formula | C25H20ClN3O2S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cs1)N/N=C/c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20ClN3O2S2/c26-21-10-6-19(7-11-21)15-31-22-12-8-18(9-13-22)14-27-29-24(30)17-33-25-28-23(16-32-25)20-4-2-1-3-5-20/h1-14,16H,15,17H2,(H,29,30)/b27-14+ |
| InChIKey | ZNTKQJVWMMHFMA-MZJWZYIUSA-N |
| XLogP | 6.28 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|