C25H19BrClN3O2S2 — CID 19194672
N-[(E)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 19194672) has the molecular formula C25H19BrClN3O2S2 and a molecular weight of 572.94 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19194672 |
| Molecular Formula | C25H19BrClN3O2S2 |
| Molecular Weight | 572.94 g/mol |
| Exact Mass | 570.98 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccc(Cl)cc2)cs1)N/N=C/c1ccc(OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H19BrClN3O2S2/c26-20-7-1-18(2-8-20)14-32-22-11-3-17(4-12-22)13-28-30-24(31)16-34-25-29-23(15-33-25)19-5-9-21(27)10-6-19/h1-13,15H,14,16H2,(H,30,31)/b28-13+ |
| InChIKey | DBKUDLBEAKLARZ-XODNFHPESA-N |
| XLogP | 7.05 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.94 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|