C18H16BrN5O2S2 — CID 19204523
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 19204523) has the molecular formula C18H16BrN5O2S2 and a molecular weight of 478.40 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19204523 |
| Molecular Formula | C18H16BrN5O2S2 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Nc1nnc(SCC(=O)NN=Cc2ccc(OCc3ccc(Br)cc3)cc2)s1 |
| InChI | InChI=1S/C18H16BrN5O2S2/c19-14-5-1-13(2-6-14)10-26-15-7-3-12(4-8-15)9-21-22-16(25)11-27-18-24-23-17(20)28-18/h1-9H,10-11H2,(H2,20,23)(H,22,25) |
| InChIKey | OOUITOOUILZVNI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|