C11H11N5O2S2 — CID 135597825
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135597825) has the molecular formula C11H11N5O2S2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135597825 |
| Molecular Formula | C11H11N5O2S2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Nc1nnc(SCC(=O)NN=Cc2ccc(O)cc2)s1 |
| InChI | InChI=1S/C11H11N5O2S2/c12-10-15-16-11(20-10)19-6-9(18)14-13-5-7-1-3-8(17)4-2-7/h1-5,17H,6H2,(H2,12,15)(H,14,18) |
| InChIKey | ZMAIROCZWJRZEK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|