C20H21N5O3S2 — CID 19204411
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]acetamide (PubChem CID 19204411) has the molecular formula C20H21N5O3S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19204411 |
| Molecular Formula | C20H21N5O3S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]acetamide |
| SMILES | COc1cc(C=NNC(=O)CSc2nnc(N)s2)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C20H21N5O3S2/c1-27-17-11-15(7-8-16(17)28-10-9-14-5-3-2-4-6-14)12-22-23-18(26)13-29-20-25-24-19(21)30-20/h2-8,11-12H,9-10,13H2,1H3,(H2,21,24)(H,23,26) |
| InChIKey | XTMYOEMXIQXXKU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|