C27H30N2O4 — CID 19183072
N-[(E)-[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide (PubChem CID 19183072) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[(E)-[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide.
| Compound Name | N-[(E)-[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 19183072 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[(E)-[3-methoxy-4-(2-phenylethoxy)phenyl]methylideneamino]-2-(2,3,6-trimethylphenoxy)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2c(C)ccc(C)c2C)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O4/c1-19-10-11-20(2)27(21(19)3)33-18-26(30)29-28-17-23-12-13-24(25(16-23)31-4)32-15-14-22-8-6-5-7-9-22/h5-13,16-17H,14-15,18H2,1-4H3,(H,29,30)/b28-17+ |
| InChIKey | DNGMDROSRNMBNY-OGLMXYFKSA-N |
| XLogP | 4.77 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|