C25H24BrClN2O4 — CID 19207863
2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 19207863) has the molecular formula C25H24BrClN2O4 and a molecular weight of 531.83 g/mol. Its IUPAC name is 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19207863 |
| Molecular Formula | C25H24BrClN2O4 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2cc(C)c(Cl)c(C)c2Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H24BrClN2O4/c1-16-11-22(24(26)17(2)25(16)27)33-15-23(30)29-28-13-19-9-10-20(21(12-19)31-3)32-14-18-7-5-4-6-8-18/h4-13H,14-15H2,1-3H3,(H,29,30)/b28-13+ |
| InChIKey | ZFESXQIWWQAOSI-XODNFHPESA-N |
| XLogP | 5.84 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|