C26H27ClN2O4 — CID 4176982
4-(4-chloro-2-methylphenoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]butanamide (PubChem CID 4176982) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 4176982 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]butanamide |
| SMILES | COc1cc(C=NNC(=O)CCCOc2ccc(Cl)cc2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H27ClN2O4/c1-19-15-22(27)11-13-23(19)32-14-6-9-26(30)29-28-17-21-10-12-24(25(16-21)31-2)33-18-20-7-4-3-5-8-20/h3-5,7-8,10-13,15-17H,6,9,14,18H2,1-2H3,(H,29,30) |
| InChIKey | ZHVNBEASRKKDTQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|