C30H26N4O3S3 — CID 4606871
N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4606871) has the molecular formula C30H26N4O3S3 and a molecular weight of 586.76 g/mol. Its IUPAC name is N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4606871 |
| Molecular Formula | C30H26N4O3S3 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1cc(C=NNC(=O)CSc2nnc(SCc3cccc4ccccc34)s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H26N4O3S3/c1-36-27-16-22(14-15-26(27)37-18-21-8-3-2-4-9-21)17-31-32-28(35)20-39-30-34-33-29(40-30)38-19-24-12-7-11-23-10-5-6-13-25(23)24/h2-17H,18-20H2,1H3,(H,32,35) |
| InChIKey | YGMFWADNGXKVQW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|