C24H22N4O4S3 — CID 2144814
N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 2144814) has the molecular formula C24H22N4O4S3 and a molecular weight of 526.67 g/mol. Its IUPAC name is N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2144814 |
| Molecular Formula | C24H22N4O4S3 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | N-[(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1cc(C=NNC(=O)CSc2nnc(SCc3cccc4ccccc34)s2)cc(OC)c1O |
| InChI | InChI=1S/C24H22N4O4S3/c1-31-19-10-15(11-20(32-2)22(19)30)12-25-26-21(29)14-34-24-28-27-23(35-24)33-13-17-8-5-7-16-6-3-4-9-18(16)17/h3-12,30H,13-14H2,1-2H3,(H,26,29) |
| InChIKey | DACPAAKFBJWKPE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|