C23H19ClN4O2S3 — CID 6865484
2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 6865484) has the molecular formula C23H19ClN4O2S3 and a molecular weight of 515.09 g/mol. Its IUPAC name is 2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6865484 |
| Molecular Formula | C23H19ClN4O2S3 |
| Molecular Weight | 515.09 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | COc1ccc2ccccc2c1/C=N/NC(=O)CSc1nnc(SCc2ccccc2Cl)s1 |
| InChI | InChI=1S/C23H19ClN4O2S3/c1-30-20-11-10-15-6-2-4-8-17(15)18(20)12-25-26-21(29)14-32-23-28-27-22(33-23)31-13-16-7-3-5-9-19(16)24/h2-12H,13-14H2,1H3,(H,26,29)/b25-12+ |
| InChIKey | APBTZYDGQUZZPN-BRJLIKDPSA-N |
| XLogP | 5.89 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.09 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|