C21H20N2O2S — CID 19208862
N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 19208862) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 19208862 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | COc1ccc2ccccc2c1/C=N/NC(=O)CSc1ccc(C)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-15-7-10-17(11-8-15)26-14-21(24)23-22-13-19-18-6-4-3-5-16(18)9-12-20(19)25-2/h3-13H,14H2,1-2H3,(H,23,24)/b22-13+ |
| InChIKey | TWKYJDDEDJVAKK-LPYMAVHISA-N |
| XLogP | 4.40 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|