C28H22N4O3S — CID 6133483
N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 6133483) has the molecular formula C28H22N4O3S and a molecular weight of 494.58 g/mol. Its IUPAC name is N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 6133483 |
| Molecular Formula | C28H22N4O3S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | COc1ccc2ccccc2c1/C=N\NC(=O)CSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H22N4O3S/c1-35-25-16-15-19-9-5-6-12-21(19)23(25)17-29-31-26(33)18-36-28-30-24-14-8-7-13-22(24)27(34)32(28)20-10-3-2-4-11-20/h2-17H,18H2,1H3,(H,31,33)/b29-17- |
| InChIKey | OSAPMROQUFKPEB-RHANQZHGSA-N |
| XLogP | 4.79 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|