C26H22N4O5S — CID 6886268
[2-methoxy-4-[(E)-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate (PubChem CID 6886268) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 6886268 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [2-methoxy-4-[(E)-[[2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(/C=N/NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccccc2)ccc1OC(C)=O |
| InChI | InChI=1S/C26H22N4O5S/c1-17(31)35-22-13-12-18(14-23(22)34-2)15-27-29-24(32)16-36-26-28-21-11-7-6-10-20(21)25(33)30(26)19-8-4-3-5-9-19/h3-15H,16H2,1-2H3,(H,29,32)/b27-15+ |
| InChIKey | PFASBFBARMZFHP-JFLMPSFJSA-N |
| XLogP | 3.56 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|