C27H23BrN4O6S — CID 4508155
[4-[[[2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 4508155) has the molecular formula C27H23BrN4O6S and a molecular weight of 611.47 g/mol. Its IUPAC name is [4-[[[2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[[[2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 4508155 |
| Molecular Formula | C27H23BrN4O6S |
| Molecular Weight | 611.47 g/mol |
| Exact Mass | 610.05 |
| IUPAC Name | [4-[[[2-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(C=NNC(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(Br)cc2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C27H23BrN4O6S/c1-16(33)38-25-22(36-2)12-17(13-23(25)37-3)14-29-31-24(34)15-39-27-30-21-7-5-4-6-20(21)26(35)32(27)19-10-8-18(28)9-11-19/h4-14H,15H2,1-3H3,(H,31,34) |
| InChIKey | ZTIDOCOVVSRICQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|