C28H26N4O6S — CID 6865829
[2,6-dimethoxy-4-[(E)-[[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate (PubChem CID 6865829) has the molecular formula C28H26N4O6S and a molecular weight of 546.61 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(E)-[[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(E)-[[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 6865829 |
| Molecular Formula | C28H26N4O6S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [2,6-dimethoxy-4-[(E)-[[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]hydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(/C=N/NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccccc2C)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C28H26N4O6S/c1-17-9-5-8-12-22(17)32-27(35)20-10-6-7-11-21(20)30-28(32)39-16-25(34)31-29-15-19-13-23(36-3)26(38-18(2)33)24(14-19)37-4/h5-15H,16H2,1-4H3,(H,31,34)/b29-15+ |
| InChIKey | VSKIWWNQBIOKTI-WKULSOCRSA-N |
| XLogP | 3.88 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|