C22H17BrN4O2S2 — CID 4507795
N-[(5-bromothiophen-2-yl)methylideneamino]-2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 4507795) has the molecular formula C22H17BrN4O2S2 and a molecular weight of 513.44 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methylideneamino]-2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methylideneamino]-2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4507795 |
| Molecular Formula | C22H17BrN4O2S2 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methylideneamino]-2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | Cc1ccccc1-n1c(SCC(=O)NN=Cc2ccc(Br)s2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H17BrN4O2S2/c1-14-6-2-5-9-18(14)27-21(29)16-7-3-4-8-17(16)25-22(27)30-13-20(28)26-24-12-15-10-11-19(23)31-15/h2-12H,13H2,1H3,(H,26,28) |
| InChIKey | LZWGHFGIONVSFY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|