C22H17ClN4O2S2 — CID 6879273
2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(5-methylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 6879273) has the molecular formula C22H17ClN4O2S2 and a molecular weight of 468.99 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(5-methylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(5-methylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6879273 |
| Molecular Formula | C22H17ClN4O2S2 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(5-methylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc(/C=N/NC(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C22H17ClN4O2S2/c1-14-6-11-17(31-14)12-24-26-20(28)13-30-22-25-19-5-3-2-4-18(19)21(29)27(22)16-9-7-15(23)8-10-16/h2-12H,13H2,1H3,(H,26,28)/b24-12+ |
| InChIKey | BBTVCOOBIHREBO-WYMPLXKRSA-N |
| XLogP | 4.65 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|