C23H16ClFN4O2S — CID 6880129
2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(2-fluorophenyl)methylideneamino]acetamide (PubChem CID 6880129) has the molecular formula C23H16ClFN4O2S and a molecular weight of 466.93 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(2-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(2-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6880129 |
| Molecular Formula | C23H16ClFN4O2S |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(E)-(2-fluorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1)N/N=C/c1ccccc1F |
| InChI | InChI=1S/C23H16ClFN4O2S/c24-16-9-11-17(12-10-16)29-22(31)18-6-2-4-8-20(18)27-23(29)32-14-21(30)28-26-13-15-5-1-3-7-19(15)25/h1-13H,14H2,(H,28,30)/b26-13+ |
| InChIKey | FWFXJKRCHPDPTG-LGJNPRDNSA-N |
| XLogP | 4.42 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|