C25H22N4O2S3 — CID 6506152
N-[(Z)-[(Z)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 6506152) has the molecular formula C25H22N4O2S3 and a molecular weight of 506.68 g/mol. Its IUPAC name is N-[(Z)-[(Z)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-[(Z)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6506152 |
| Molecular Formula | C25H22N4O2S3 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | N-[(Z)-[(Z)-3-(2-methoxyphenyl)prop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccccc1/C=C\C=N/NC(=O)CSc1nnc(SCc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C25H22N4O2S3/c1-31-22-14-5-3-9-19(22)12-7-15-26-27-23(30)17-33-25-29-28-24(34-25)32-16-20-11-6-10-18-8-2-4-13-21(18)20/h2-15H,16-17H2,1H3,(H,27,30)/b12-7-,26-15- |
| InChIKey | WILQGSKEXVNXRF-LDJHPSCQSA-N |
| XLogP | 5.90 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|