C24H19N5O3S3 — CID 6804185
2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide (PubChem CID 6804185) has the molecular formula C24H19N5O3S3 and a molecular weight of 521.65 g/mol. Its IUPAC name is 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide.
| Compound Name | 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide |
|---|---|
| PubChem CID | 6804185 |
| Molecular Formula | C24H19N5O3S3 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(2-nitrophenyl)prop-2-enylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(SCc2cccc3ccccc23)s1)NN=CC=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H19N5O3S3/c30-22(26-25-14-6-11-18-8-2-4-13-21(18)29(31)32)16-34-24-28-27-23(35-24)33-15-19-10-5-9-17-7-1-3-12-20(17)19/h1-14H,15-16H2,(H,26,30) |
| InChIKey | ZMGRSKAQGOBNFR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|