C24H19ClN4OS3 — CID 6862829
N-[(E)-[(E)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 6862829) has the molecular formula C24H19ClN4OS3 and a molecular weight of 511.10 g/mol. Its IUPAC name is N-[(E)-[(E)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-[(E)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6862829 |
| Molecular Formula | C24H19ClN4OS3 |
| Molecular Weight | 511.10 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | N-[(E)-[(E)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(SCc2cccc3ccccc23)s1)N/N=C/C(Cl)=C\c1ccccc1 |
| InChI | InChI=1S/C24H19ClN4OS3/c25-20(13-17-7-2-1-3-8-17)14-26-27-22(30)16-32-24-29-28-23(33-24)31-15-19-11-6-10-18-9-4-5-12-21(18)19/h1-14H,15-16H2,(H,27,30)/b20-13+,26-14+ |
| InChIKey | KHAZEJDVGCIJDN-OUDSLWFUSA-N |
| XLogP | 6.46 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.10 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|