C22H16Br2N4O2S3 — CID 135629862
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 135629862) has the molecular formula C22H16Br2N4O2S3 and a molecular weight of 624.41 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 135629862 |
| Molecular Formula | C22H16Br2N4O2S3 |
| Molecular Weight | 624.41 g/mol |
| Exact Mass | 621.88 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(SCc2cccc3ccccc23)s1)N/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C22H16Br2N4O2S3/c23-16-8-15(20(30)18(24)9-16)10-25-26-19(29)12-32-22-28-27-21(33-22)31-11-14-6-3-5-13-4-1-2-7-17(13)14/h1-10,30H,11-12H2,(H,26,29)/b25-10+ |
| InChIKey | HBGGZEHGZOUZOW-KIBLKLHPSA-N |
| XLogP | 6.46 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|