C18H16N4O2S3 — CID 136911175
2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 136911175) has the molecular formula C18H16N4O2S3 and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136911175 |
| Molecular Formula | C18H16N4O2S3 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(SCc2ccccc2)s1)N/N=C\c1ccccc1O |
| InChI | InChI=1S/C18H16N4O2S3/c23-15-9-5-4-8-14(15)10-19-20-16(24)12-26-18-22-21-17(27-18)25-11-13-6-2-1-3-7-13/h1-10,23H,11-12H2,(H,20,24)/b19-10- |
| InChIKey | YKHOILKMXYNEAT-GRSHGNNSSA-N |
| XLogP | 3.78 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|