C19H18N4O2S3 — CID 6865063
2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 6865063) has the molecular formula C19H18N4O2S3 and a molecular weight of 430.58 g/mol. Its IUPAC name is 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6865063 |
| Molecular Formula | C19H18N4O2S3 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-(2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccccc1/C=N/NC(=O)CSc1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C19H18N4O2S3/c1-25-16-10-6-5-9-15(16)11-20-21-17(24)13-27-19-23-22-18(28-19)26-12-14-7-3-2-4-8-14/h2-11H,12-13H2,1H3,(H,21,24)/b20-11+ |
| InChIKey | AAVPQNJZQQCRFI-RGVLZGJSSA-N |
| XLogP | 4.08 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|