C20H16ClN5OS3 — CID 135521445
2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide (PubChem CID 135521445) has the molecular formula C20H16ClN5OS3 and a molecular weight of 474.04 g/mol. Its IUPAC name is 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide.
| Compound Name | 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 135521445 |
| Molecular Formula | C20H16ClN5OS3 |
| Molecular Weight | 474.04 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(SCc2ccc(Cl)cc2)s1)N/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H16ClN5OS3/c21-15-7-5-13(6-8-15)11-28-19-25-26-20(30-19)29-12-18(27)24-23-10-14-9-22-17-4-2-1-3-16(14)17/h1-10,22H,11-12H2,(H,24,27)/b23-10+ |
| InChIKey | HZNIIVLXLZHRBE-AUEPDCJTSA-N |
| XLogP | 5.21 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.04 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|